EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:45564 - 5-hydroxypentanoic acid
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | O=C(O)CCCCO |
| InChI | InChI=1S/C5H10O3/c6-4-2-1-3-5(7)8/h6H,1-4H2,(H,7,8) |
| InChIKey | PHOJOSOUIAQEDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxypentanoic acid (CHEBI:45564) has functional parent valeric acid (CHEBI:17418) |
| 5-hydroxypentanoic acid (CHEBI:45564) is a 5-hydroxy monocarboxylic acid (CHEBI:37125) |
| 5-hydroxypentanoic acid (CHEBI:45564) is a straight-chain fatty acid (CHEBI:59202) |
| 5-hydroxypentanoic acid (CHEBI:45564) is a ω-hydroxy-short-chain fatty acid (CHEBI:194306) |
| 5-hydroxypentanoic acid (CHEBI:45564) is conjugate acid of 5-hydroxypentanoate (CHEBI:16230) |
| Incoming Relation(s) |
| 1-O-hexadecyl-2-(5-hydroxyvaleroyl)-sn-glycero-3-phosphocholine (CHEBI:142765) has functional parent 5-hydroxypentanoic acid (CHEBI:45564) |
| 1-palmitoyl-2-(5-hydroxyvaleroyl)-sn-glycero-3-phosphocholine (CHEBI:142747) has functional parent 5-hydroxypentanoic acid (CHEBI:45564) |
| 5-hydroxypentanoyl-CoA (CHEBI:15501) has functional parent 5-hydroxypentanoic acid (CHEBI:45564) |
| icos#9 (CHEBI:79116) has functional parent 5-hydroxypentanoic acid (CHEBI:45564) |
| oscr#9 (CHEBI:79133) has functional parent 5-hydroxypentanoic acid (CHEBI:45564) |
| 5-hydroxypentanoate (CHEBI:16230) is conjugate base of 5-hydroxypentanoic acid (CHEBI:45564) |
| IUPAC Name |
|---|
| 5-hydroxypentanoic acid |
| Synonyms | Source |
|---|---|
| 4-Oxy-butan-carbonsäure | ChEBI |
| 5-Hydroxy-pentansäure | ChEBI |
| 5-Hydroxy-valeriansäure | ChEBI |
| 5-hydroxyvaleric acid | ChemIDplus |
| δ-hydroxypentanoic acid | ChemIDplus |
| δ-hydroxyvaleric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02804 | KEGG COMPOUND |
| DB04781 | DrugBank |
| LMFA01050010 | LIPID MAPS |
| SHO | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1700765 | Beilstein |
| Reaxys:1700765 | Reaxys |
| CAS:13392-69-3 | ChemIDplus |