EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O4 |
| Net Charge | 0 |
| Average Mass | 320.429 |
| Monoisotopic Mass | 320.19876 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1O)C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C19H28O4/c1-11-7-13-4-3-12(2)16(19(13)17(21)8-11)6-5-15-9-14(20)10-18(22)23-15/h3-4,7,11-12,14-17,19-21H,5-6,8-10H2,1-2H3/t11-,12-,14+,15+,16-,17-,19-/m0/s1 |
| InChIKey | ZDFOBOYQVYMVCW-IRUSZSJRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monascus ruber (ncbitaxon:89489) | - | PubMed (3839227) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monacolin J (CHEBI:79034) has functional parent monacolin L (CHEBI:50130) |
| monacolin J (CHEBI:79034) has role antimicrobial agent (CHEBI:33281) |
| monacolin J (CHEBI:79034) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| monacolin J (CHEBI:79034) has role fungal metabolite (CHEBI:76946) |
| monacolin J (CHEBI:79034) is a 2-pyranones (CHEBI:75885) |
| monacolin J (CHEBI:79034) is a carbobicyclic compound (CHEBI:36785) |
| monacolin J (CHEBI:79034) is a hexahydronaphthalenes (CHEBI:142348) |
| monacolin J (CHEBI:79034) is a polyketide (CHEBI:26188) |
| monacolin J (CHEBI:79034) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| monacolin J acid (CHEBI:82971) has functional parent monacolin J (CHEBI:79034) |
| IUPAC Name |
|---|
| (4R,6R)-4-hydroxy-6-{2-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}tetrahydro-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| Antibiotic MB 530A | KNApSAcK |
| Lovastatin diol lactone | KNApSAcK |
| Monacolin J | KNApSAcK |
| monacolin J lactone | ChEBI |
| UniProt Name | Source |
|---|---|
| monacolin J | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00018632 | KNApSAcK |
| Monacolin_J | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4758897 | Reaxys |
| CAS:79952-42-4 | ChemIDplus |
| Citations |
|---|