EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O5 |
| Net Charge | 0 |
| Average Mass | 338.444 |
| Monoisotopic Mass | 338.20932 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1O)C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C19H30O5/c1-11-7-13-4-3-12(2)16(19(13)17(22)8-11)6-5-14(20)9-15(21)10-18(23)24/h3-4,7,11-12,14-17,19-22H,5-6,8-10H2,1-2H3,(H,23,24)/t11-,12-,14+,15+,16-,17-,19-/m0/s1 |
| InChIKey | FJQFRDAWQRBFCG-IRUSZSJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monascus ruber (ncbitaxon:89489) | - | PubMed (3839227) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monacolin J acid (CHEBI:82971) has functional parent monacolin J (CHEBI:79034) |
| monacolin J acid (CHEBI:82971) has role fungal metabolite (CHEBI:76946) |
| monacolin J acid (CHEBI:82971) is a hexahydronaphthalenes (CHEBI:142348) |
| monacolin J acid (CHEBI:82971) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| monacolin J acid (CHEBI:82971) is a polyketide (CHEBI:26188) |
| monacolin J acid (CHEBI:82971) is conjugate acid of monacolin J carboxylate (CHEBI:79035) |
| Incoming Relation(s) |
| monacolin J carboxylate (CHEBI:79035) is conjugate base of monacolin J acid (CHEBI:82971) |
| IUPAC Name |
|---|
| (3R,5R)-3,5-dihydroxy-7-[(1S,2S,6R,8S,8aR)-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9437849 | Reaxys |
| Citations |
|---|