EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@]12CC[C@@H](C)C=C1C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C19H28O3/c1-12-3-7-18-14(9-12)5-4-13(2)17(18)8-6-16-10-15(20)11-19(21)22-16/h4-5,9,12-13,15-18,20H,3,6-8,10-11H2,1-2H3/t12-,13+,15-,16-,17+,18+/m1/s1 |
| InChIKey | BKZPCUPKVCPRQW-MHMDBQTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | PubMed (24534845) | Strain: ATCC 20542 |
| Monascus ruber (ncbitaxon:89489) | - | PubMed (3839227) | Strain: M 4681 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monacolin L (CHEBI:50130) has role Aspergillus metabolite (CHEBI:76956) |
| monacolin L (CHEBI:50130) has role anticholesteremic drug (CHEBI:35821) |
| monacolin L (CHEBI:50130) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| monacolin L (CHEBI:50130) is a 2-pyranones (CHEBI:75885) |
| monacolin L (CHEBI:50130) is a hexahydronaphthalenes (CHEBI:142348) |
| monacolin L (CHEBI:50130) is a polyketide (CHEBI:26188) |
| monacolin L (CHEBI:50130) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| dihydromonacolin L (CHEBI:14158) has functional parent monacolin L (CHEBI:50130) |
| monacolin J (CHEBI:79034) has functional parent monacolin L (CHEBI:50130) |
| monacolin L acid (CHEBI:82987) has functional parent monacolin L (CHEBI:50130) |
| IUPAC Name |
|---|
| (4R,6R)-6-{2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}-4-hydroxyoxan-2-one |
| Synonyms | Source |
|---|---|
| (4R,6R)-6-{2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}-4-hydroxytetrahydro-2H-pyran-2-one | IUPAC |
| monacolin L lactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00018633 | KNApSAcK |
| KR20040016648 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8791298 | Reaxys |
| CAS:79394-47-1 | ChemIDplus |
| Citations |
|---|