EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O3 |
| Net Charge | 0 |
| Average Mass | 326.521 |
| Monoisotopic Mass | 326.28210 |
| SMILES | C[C@@H](O)CCCCCCCCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C20H38O3/c1-19(21)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20(22)23/h16,18-19,21H,2-15,17H2,1H3,(H,22,23)/b18-16+/t19-/m1/s1 |
| InChIKey | MRCRUNUUPSVOFD-WNZNBFKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) has functional parent trans-2-icosenoic acid (CHEBI:79014) |
| (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) is a long-chain fatty acid (CHEBI:15904) |
| (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| ascr#35 (CHEBI:78973) has functional parent (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) |
| IUPAC Name |
|---|
| (2E,19R)-19-hydroxyicos-2-enoic acid |
| Synonym | Source |
|---|---|
| (2E,19R)-19-hydroxyeicos-2-enoic acid | ChEBI |