EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H48O6 |
| Net Charge | 0 |
| Average Mass | 456.664 |
| Monoisotopic Mass | 456.34509 |
| SMILES | C[C@H](CCCCCCCCCCCCCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C26H48O6/c1-21(31-26-24(28)20-23(27)22(2)32-26)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-25(29)30/h17,19,21-24,26-28H,3-16,18,20H2,1-2H3,(H,29,30)/b19-17+/t21-,22+,23-,24-,26-/m1/s1 |
| InChIKey | GIUKRFWFBBFDTQ-LAOJQUNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Found in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#35 (CHEBI:78973) has functional parent (2E,19R)-19-hydroxyicos-2-enoic acid (CHEBI:79013) |
| ascr#35 (CHEBI:78973) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#35 (CHEBI:78973) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#35 (CHEBI:78973) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#35 (CHEBI:78973) is conjugate acid of ascr#35(1-) (CHEBI:139693) |
| Incoming Relation(s) |
| ascr#35(1-) (CHEBI:139693) is conjugate base of ascr#35 (CHEBI:78973) |
| Synonyms | Source |
|---|---|
| 19R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-eicosenoic acid | ChEBI |
| 19R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-icosenoic acid | SMID |
| (2E,19R)-19-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]eicos-2-enoic acid | ChEBI |
| (2E,19R)-19-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]icos-2-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%2335%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233489 | Reaxys |
| CAS:1355681-85-4 | SMID |
| Citations |
|---|