EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:78978 - (11R)-11-hydroxylauric acid
| Formula | C12H24O3 |
| Net Charge | 0 |
| Average Mass | 216.321 |
| Monoisotopic Mass | 216.17254 |
| SMILES | C[C@@H](O)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H24O3/c1-11(13)9-7-5-3-2-4-6-8-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | KQGAHNAFXMVSGY-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11R)-11-hydroxylauric acid (CHEBI:78978) is a 11-hydroxylauric acid (CHEBI:76937) |
| (11R)-11-hydroxylauric acid (CHEBI:78978) is conjugate acid of (R)-11-hydroxylaurate(1−) (CHEBI:78423) |
| Incoming Relation(s) |
| (3R,11R)-3,11-dihydroxylauric acid (CHEBI:79243) has functional parent (11R)-11-hydroxylauric acid (CHEBI:78978) |
| ascr#20 (CHEBI:78958) has functional parent (11R)-11-hydroxylauric acid (CHEBI:78978) |
| icas#20 (CHEBI:78745) has functional parent (11R)-11-hydroxylauric acid (CHEBI:78978) |
| (R)-11-hydroxylaurate(1−) (CHEBI:78423) is conjugate base of (11R)-11-hydroxylauric acid (CHEBI:78978) |
| IUPAC Name |
|---|
| (11R)-11-hydroxydodecanoic acid |
| Synonyms | Source |
|---|---|
| (11R)-hydroxydodecanoic acid | ChEBI |
| (11R)-hydroxylauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050253 | LIPID MAPS |