EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO7 |
| Net Charge | 0 |
| Average Mass | 489.609 |
| Monoisotopic Mass | 489.27265 |
| SMILES | C[C@H](CCCCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C27H39NO7/c1-18(12-8-6-4-3-5-7-9-15-25(30)31)33-27-23(29)16-24(19(2)34-27)35-26(32)21-17-28-22-14-11-10-13-20(21)22/h10-11,13-14,17-19,23-24,27-29H,3-9,12,15-16H2,1-2H3,(H,30,31)/t18-,19+,23-,24-,27-/m1/s1 |
| InChIKey | AFPJDDPSVYDRDB-DRONAGRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icas#20 (CHEBI:78745) has functional parent (11R)-11-hydroxylauric acid (CHEBI:78978) |
| icas#20 (CHEBI:78745) has functional parent ascr#20 (CHEBI:78958) |
| icas#20 (CHEBI:78745) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| icas#20 (CHEBI:78745) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| icas#20 (CHEBI:78745) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| icas#20 (CHEBI:78745) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| ibha#20 (CHEBI:79355) has functional parent icas#20 (CHEBI:78745) |
| IUPAC Name |
|---|
| (11R)-11-[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyloxy]dodecanoic acid |
| Synonyms | Source |
|---|---|
| (11R)-11-({(2R,3R,5R,6S)-3-hydroxy-5-[(1H-indol-3-ylcarbonyl)oxy]-6-methyltetrahydro-2H-pyran-2-yl}oxy)dodecanoic acid | IUPAC |
| 11R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-dodecanoic acid | SMID |
| (11R)-11-[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyloxy]lauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| icas%2320%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233501 | Reaxys |
| CAS:1355683-09-8 | SMID |
| Citations |
|---|