EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O6 |
| Net Charge | 0 |
| Average Mass | 346.464 |
| Monoisotopic Mass | 346.23554 |
| SMILES | C[C@H](CCCCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H34O6/c1-13(23-18-16(20)12-15(19)14(2)24-18)10-8-6-4-3-5-7-9-11-17(21)22/h13-16,18-20H,3-12H2,1-2H3,(H,21,22)/t13-,14+,15-,16-,18-/m1/s1 |
| InChIKey | SNWMNYQPRXIDAR-ORDFZIBCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) and daf-22(ok693), dhs-28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#20 (CHEBI:78958) has functional parent (11R)-11-hydroxylauric acid (CHEBI:78978) |
| ascr#20 (CHEBI:78958) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#20 (CHEBI:78958) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#20 (CHEBI:78958) is a monocarboxylic acid (CHEBI:25384) |
| ascr#20 (CHEBI:78958) is conjugate acid of ascr#20(1-) (CHEBI:139647) |
| Incoming Relation(s) |
| bhas#20 (CHEBI:79230) has functional parent ascr#20 (CHEBI:78958) |
| glas#20 (CHEBI:79304) has functional parent ascr#20 (CHEBI:78958) |
| icas#20 (CHEBI:78745) has functional parent ascr#20 (CHEBI:78958) |
| ascr#20(1-) (CHEBI:139647) is conjugate base of ascr#20 (CHEBI:78958) |
| IUPAC Name |
|---|
| (11R)-11-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]dodecanoic acid |
| Synonyms | Source |
|---|---|
| 11R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-dodecanoic acid | SMID |
| 11R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-lauric acid | ChEBI |
| (11R)-11-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]lauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%2320%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233413 | Reaxys |
| CAS:1355681-57-0 | SMID |
| Citations |
|---|