EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O3 |
| Net Charge | 0 |
| Average Mass | 216.321 |
| Monoisotopic Mass | 216.17254 |
| SMILES | CC(O)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H24O3/c1-11(13)9-7-5-3-2-4-6-8-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) |
| InChIKey | KQGAHNAFXMVSGY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-hydroxylauric acid (CHEBI:76937) has functional parent dodecanoic acid (CHEBI:30805) |
| 11-hydroxylauric acid (CHEBI:76937) has role metabolite (CHEBI:25212) |
| 11-hydroxylauric acid (CHEBI:76937) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 11-hydroxylauric acid (CHEBI:76937) is a medium-chain fatty acid (CHEBI:59554) |
| 11-hydroxylauric acid (CHEBI:76937) is conjugate acid of 11-hydroxylaurate (CHEBI:76628) |
| Incoming Relation(s) |
| (11R)-11-hydroxylauric acid (CHEBI:78978) is a 11-hydroxylauric acid (CHEBI:76937) |
| 11-hydroxylaurate (CHEBI:76628) is conjugate base of 11-hydroxylauric acid (CHEBI:76937) |
| IUPAC Name |
|---|
| 11-hydroxydodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050165 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1937045 | Reaxys |
| CAS:32459-66-8 | ChemIDplus |
| Citations |
|---|