EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34O6 |
| Net Charge | 0 |
| Average Mass | 358.475 |
| Monoisotopic Mass | 358.23554 |
| SMILES | C[C@H](CCCCCCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H34O6/c1-14(24-19-17(21)13-16(20)15(2)25-19)11-9-7-5-3-4-6-8-10-12-18(22)23/h10,12,14-17,19-21H,3-9,11,13H2,1-2H3,(H,22,23)/b12-10+/t14-,15+,16-,17-,19-/m1/s1 |
| InChIKey | XUGAOOQYBZSMCP-ZXSNAGKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and a major ascaroside detected in maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#21 (CHEBI:78959) has functional parent (2E,12R)-12-hydroxytridec-2-enoic acid (CHEBI:78979) |
| ascr#21 (CHEBI:78959) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#21 (CHEBI:78959) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#21 (CHEBI:78959) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#21 (CHEBI:78959) is conjugate acid of ascr#21(1-) (CHEBI:139650) |
| Incoming Relation(s) |
| ascr#21-CoA (CHEBI:139651) has functional parent ascr#21 (CHEBI:78959) |
| icas#21 (CHEBI:79107) has functional parent ascr#21 (CHEBI:78959) |
| ascr#21(1-) (CHEBI:139650) is conjugate base of ascr#21 (CHEBI:78959) |
| IUPAC Name |
|---|
| (2E,12R)-12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]tridec-2-enoic acid |
| Synonym | Source |
|---|---|
| 12R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-tridecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2321%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233420 | Reaxys |
| CAS:1355681-13-8 | Reaxys |
| CAS:1355681-57-0 | SMID |
| Citations |
|---|