EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39NO7 |
| Net Charge | 0 |
| Average Mass | 501.620 |
| Monoisotopic Mass | 501.27265 |
| SMILES | C[C@H](CCCCCCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C28H39NO7/c1-19(13-9-7-5-3-4-6-8-10-16-26(31)32)34-28-24(30)17-25(20(2)35-28)36-27(33)22-18-29-23-15-12-11-14-21(22)23/h10-12,14-16,18-20,24-25,28-30H,3-9,13,17H2,1-2H3,(H,31,32)/b16-10+/t19-,20+,24-,25-,28-/m1/s1 |
| InChIKey | KBWMSHDNIKOFRU-IROGMXPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icas#21 (CHEBI:79107) has functional parent (2E,12R)-12-hydroxytridec-2-enoic acid (CHEBI:78979) |
| icas#21 (CHEBI:79107) has functional parent ascr#21 (CHEBI:78959) |
| icas#21 (CHEBI:79107) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| icas#21 (CHEBI:79107) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| icas#21 (CHEBI:79107) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| icas#21 (CHEBI:79107) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Manual Xrefs | Databases |
|---|---|
| icas%2321%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233498 | Reaxys |
| CAS:1355683-10-1 | SMID |
| Citations |
|---|