EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H68N7O21P3S |
| Net Charge | 0 |
| Average Mass | 1108.001 |
| Monoisotopic Mass | 1107.34018 |
| SMILES | C[C@H](CCCCCCCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C40H68N7O21P3S/c1-24(64-39-27(49)19-26(48)25(2)65-39)13-11-9-7-5-6-8-10-12-14-30(51)72-18-17-42-29(50)15-16-43-37(54)34(53)40(3,4)21-63-71(60,61)68-70(58,59)62-20-28-33(67-69(55,56)57)32(52)38(66-28)47-23-46-31-35(41)44-22-45-36(31)47/h12,14,22-28,32-34,38-39,48-49,52-53H,5-11,13,15-21H2,1-4H3,(H,42,50)(H,43,54)(H,58,59)(H,60,61)(H2,41,44,45)(H2,55,56,57)/b14-12+/t24-,25+,26-,27-,28-,32-,33-,34+,38-,39-/m1/s1 |
| InChIKey | IJFOVOXYTMJNNT-OMZVDAQLSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#21-CoA (CHEBI:139651) has functional parent ascr#21 (CHEBI:78959) |
| ascr#21-CoA (CHEBI:139651) is a acyl-CoA (CHEBI:17984) |
| ascr#21-CoA (CHEBI:139651) is conjugate acid of ascr#21-CoA(4−) (CHEBI:139652) |
| Incoming Relation(s) |
| ascr#21-CoA(4−) (CHEBI:139652) is conjugate base of ascr#21-CoA (CHEBI:139651) |
| Synonym | Source |
|---|---|
| ascr#21-coenzyme A | ChEBI |