EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O7 |
| Net Charge | 0 |
| Average Mass | 362.463 |
| Monoisotopic Mass | 362.23045 |
| SMILES | C[C@H](CCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H34O7/c1-12(24-18-16(21)11-15(20)13(2)25-18)8-6-4-3-5-7-9-14(19)10-17(22)23/h12-16,18-21H,3-11H2,1-2H3,(H,22,23)/t12-,13+,14-,15-,16-,18-/m1/s1 |
| InChIKey | LOQQYUUEPVHUQQ-RDEONCLASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#20 (CHEBI:79230) has functional parent (3R,11R)-3,11-dihydroxylauric acid (CHEBI:79243) |
| bhas#20 (CHEBI:79230) has functional parent ascr#20 (CHEBI:78958) |
| bhas#20 (CHEBI:79230) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#20 (CHEBI:79230) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#20 (CHEBI:79230) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#20 (CHEBI:79230) is a monocarboxylic acid (CHEBI:25384) |
| bhas#20 (CHEBI:79230) is conjugate acid of bhas#20(1-) (CHEBI:139738) |
| Incoming Relation(s) |
| ibha#20 (CHEBI:79355) has functional parent bhas#20 (CHEBI:79230) |
| bhas#20(1-) (CHEBI:139738) is conjugate base of bhas#20 (CHEBI:79230) |
| IUPAC Name |
|---|
| (3R,11R)-11-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxydodecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-11R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-dodecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2320%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233424 | Reaxys |
| CAS:1355682-54-0 | SMID |
| Citations |
|---|