EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O6 |
| Net Charge | 0 |
| Average Mass | 332.437 |
| Monoisotopic Mass | 332.21989 |
| SMILES | C[C@H](CCCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H32O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h12-15,17-19H,3-11H2,1-2H3,(H,20,21)/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | AHRWSOYISAIFOZ-JRBZFYFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) and dhs-28(hj8) and maoc-1(hj13) mutant worms. A major ascaroside in acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#18 (CHEBI:78955) has functional parent (10R)-10-hydroxyundecanoic acid (CHEBI:78956) |
| ascr#18 (CHEBI:78955) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#18 (CHEBI:78955) is a monocarboxylic acid (CHEBI:25384) |
| ascr#18 (CHEBI:78955) is conjugate acid of ascr#18(1−) (CHEBI:139639) |
| Incoming Relation(s) |
| bhas#18 (CHEBI:79229) has functional parent ascr#18 (CHEBI:78955) |
| glas#18 (CHEBI:79303) has functional parent ascr#18 (CHEBI:78955) |
| icas#18 (CHEBI:79105) has functional parent ascr#18 (CHEBI:78955) |
| ascr#18(1−) (CHEBI:139639) is conjugate base of ascr#18 (CHEBI:78955) |
| IUPAC Name |
|---|
| (10R)-10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]undecanoic acid |
| Synonyms | Source |
|---|---|
| 10R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-undecanoic acid | SMID |
| asc-C11 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%2318%0D | SMID |
| LMFA13040009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233406 | Reaxys |
| Citations |
|---|