EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H31O6 |
| Net Charge | -1 |
| Average Mass | 331.429 |
| Monoisotopic Mass | 331.21261 |
| SMILES | C[C@H](CCCCCCCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H32O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h12-15,17-19H,3-11H2,1-2H3,(H,20,21)/p-1/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | AHRWSOYISAIFOZ-JRBZFYFNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#18(1−) (CHEBI:139639) is a organic molecular entity (CHEBI:50860) |
| ascr#18(1−) (CHEBI:139639) is conjugate base of ascr#18 (CHEBI:78955) |
| Incoming Relation(s) |
| ascr#18 (CHEBI:78955) is conjugate acid of ascr#18(1−) (CHEBI:139639) |
| Synonyms | Source |
|---|---|
| (10R)-10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]undecanoate | ChEBI |
| asc-C11(1−) | ChEBI |
| asc-C11 anion | ChEBI |
| ascr#18 anion | ChEBI |