EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O7 |
| Net Charge | 0 |
| Average Mass | 348.436 |
| Monoisotopic Mass | 348.21480 |
| SMILES | C[C@H](CCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H32O7/c1-11(23-17-15(20)10-14(19)12(2)24-17)7-5-3-4-6-8-13(18)9-16(21)22/h11-15,17-20H,3-10H2,1-2H3,(H,21,22)/t11-,12+,13-,14-,15-,17-/m1/s1 |
| InChIKey | NJSZAOQCCDFSCR-DZGCXMPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panagrellus redivivus (ncbitaxon:6233) | - | PubMed (23213209) | Produced by male. |
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) and dhs-28(hj8), maoc-1(hj13), and acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#18 (CHEBI:79229) has functional parent (3R,10R)-3,10-dihydroxyundecanoic acid (CHEBI:79242) |
| bhas#18 (CHEBI:79229) has functional parent ascr#18 (CHEBI:78955) |
| bhas#18 (CHEBI:79229) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#18 (CHEBI:79229) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#18 (CHEBI:79229) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#18 (CHEBI:79229) is a monocarboxylic acid (CHEBI:25384) |
| bhas#18 (CHEBI:79229) is conjugate acid of bhas#18(1-) (CHEBI:139733) |
| Incoming Relation(s) |
| ibha#18 (CHEBI:79354) has functional parent bhas#18 (CHEBI:79229) |
| bhas#18(1-) (CHEBI:139733) is conjugate base of bhas#18 (CHEBI:79229) |
| IUPAC Name |
|---|
| (3R,10R)-10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyundecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-10R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-undecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2318%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233412 | Reaxys |
| CAS:1355682-52-8 | SMID |
| Citations |
|---|