EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H42O11 |
| Net Charge | 0 |
| Average Mass | 494.578 |
| Monoisotopic Mass | 494.27271 |
| SMILES | C[C@H](CCCCCCCCC(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H42O11/c1-13(31-22-16(26)11-15(25)14(2)32-22)9-7-5-3-4-6-8-10-18(27)34-23-21(30)20(29)19(28)17(12-24)33-23/h13-17,19-26,28-30H,3-12H2,1-2H3/t13-,14+,15-,16-,17-,19-,20+,21-,22-,23+/m1/s1 |
| InChIKey | QBDRWZBYGHVNSP-BZNPLBMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glas#18 (CHEBI:79303) has functional parent ascr#18 (CHEBI:78955) |
| glas#18 (CHEBI:79303) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| glas#18 (CHEBI:79303) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| glas#18 (CHEBI:79303) is a ascarosyloxycarboxylic acid β-D-glucopyranosyl ester (CHEBI:79198) |
| IUPAC Name |
|---|
| 1-O-{(10R)-10-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]undecanoyl}-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| β-D-glucos-1''-yl-10R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-undecanoate | SMID |
| Manual Xrefs | Databases |
|---|---|
| glas%2318 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233522 | Reaxys |
| CAS:1355683-57-6 | SMID |
| Citations |
|---|