EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O6 |
| Net Charge | 0 |
| Average Mass | 318.410 |
| Monoisotopic Mass | 318.20424 |
| SMILES | C[C@H](CCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O6/c1-11(8-6-4-3-5-7-9-15(19)20)21-16-14(18)10-13(17)12(2)22-16/h11-14,16-18H,3-10H2,1-2H3,(H,19,20)/t11-,12+,13-,14-,16-/m1/s1 |
| InChIKey | UMKVAMCFIAMCAV-JTTNIQEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Found in dhs-28(hj8), maoc-1(hj13), and acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#16 (CHEBI:78950) has functional parent (9R)-9-hydroxydecanoic acid (CHEBI:78951) |
| ascr#16 (CHEBI:78950) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#16 (CHEBI:78950) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#16 (CHEBI:78950) is a monocarboxylic acid (CHEBI:25384) |
| ascr#16 (CHEBI:78950) is conjugate acid of ascr#16(1−) (CHEBI:139633) |
| Incoming Relation(s) |
| bhas#16 (CHEBI:79227) has functional parent ascr#16 (CHEBI:78950) |
| glas#16 (CHEBI:79302) has functional parent ascr#16 (CHEBI:78950) |
| icas#16 (CHEBI:79094) has functional parent ascr#16 (CHEBI:78950) |
| ascr#16(1−) (CHEBI:139633) is conjugate base of ascr#16 (CHEBI:78950) |
| IUPAC Name |
|---|
| (9R)-9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]decanoic acid |
| Synonym | Source |
|---|---|
| 9R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-decanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2316%0D | SMID |
| LMFA13040035 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233391 | Reaxys |
| CAS:1186217-53-7 | SMID |
| Citations |
|---|