EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H40O11 |
| Net Charge | 0 |
| Average Mass | 480.551 |
| Monoisotopic Mass | 480.25706 |
| SMILES | C[C@H](CCCCCCCC(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H40O11/c1-12(30-21-15(25)10-14(24)13(2)31-21)8-6-4-3-5-7-9-17(26)33-22-20(29)19(28)18(27)16(11-23)32-22/h12-16,18-25,27-29H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,18-,19+,20-,21-,22+/m1/s1 |
| InChIKey | YGECYZAESCGRDN-XXPWOUKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glas#16 (CHEBI:79302) has functional parent ascr#16 (CHEBI:78950) |
| glas#16 (CHEBI:79302) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| glas#16 (CHEBI:79302) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| glas#16 (CHEBI:79302) is a ascarosyloxycarboxylic acid β-D-glucopyranosyl ester (CHEBI:79198) |
| IUPAC Name |
|---|
| 1-O-{(9R)-9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]decanoyl}-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| β-D-glucos-1''-yl-9R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-decanoate | SMID |
| Manual Xrefs | Databases |
|---|---|
| glas%2316 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233515 | Reaxys |
| CAS:1355683-55-4 | SMID |
| Citations |
|---|