EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29O6 |
| Net Charge | -1 |
| Average Mass | 317.402 |
| Monoisotopic Mass | 317.19696 |
| SMILES | C[C@H](CCCCCCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O6/c1-11(8-6-4-3-5-7-9-15(19)20)21-16-14(18)10-13(17)12(2)22-16/h11-14,16-18H,3-10H2,1-2H3,(H,19,20)/p-1/t11-,12+,13-,14-,16-/m1/s1 |
| InChIKey | UMKVAMCFIAMCAV-JTTNIQEDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#16(1−) (CHEBI:139633) is a monocarboxylic acid anion (CHEBI:35757) |
| ascr#16(1−) (CHEBI:139633) is conjugate base of ascr#16 (CHEBI:78950) |
| Incoming Relation(s) |
| ascr#16 (CHEBI:78950) is conjugate acid of ascr#16(1−) (CHEBI:139633) |
| IUPAC Name |
|---|
| (9R)-9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]decanoate |
| Synonym | Source |
|---|---|
| ascr#16 anion | ChEBI |