EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O7 |
| Net Charge | 0 |
| Average Mass | 334.409 |
| Monoisotopic Mass | 334.19915 |
| SMILES | C[C@H](CCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O7/c1-10(6-4-3-5-7-12(17)8-15(20)21)22-16-14(19)9-13(18)11(2)23-16/h10-14,16-19H,3-9H2,1-2H3,(H,20,21)/t10-,11+,12-,13-,14-,16-/m1/s1 |
| InChIKey | XLKCBPRCWUMKHY-NVWMEEMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#16 (CHEBI:79227) has functional parent (3R,9R)-3,9-dihydroxydecanoic acid (CHEBI:79228) |
| bhas#16 (CHEBI:79227) has functional parent ascr#16 (CHEBI:78950) |
| bhas#16 (CHEBI:79227) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#16 (CHEBI:79227) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#16 (CHEBI:79227) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#16 (CHEBI:79227) is a monocarboxylic acid (CHEBI:25384) |
| bhas#16 (CHEBI:79227) is conjugate acid of bhas#16(1-) (CHEBI:139730) |
| Incoming Relation(s) |
| ibha#16 (CHEBI:79353) has functional parent bhas#16 (CHEBI:79227) |
| bhas#16(1-) (CHEBI:139730) is conjugate base of bhas#16 (CHEBI:79227) |
| IUPAC Name |
|---|
| (3R,9R)-9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxydecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-9R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-decanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2316%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233407 | Reaxys |
| CAS:1355682-50-6 | SMID |
| Citations |
|---|