EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O8 |
| Net Charge | 0 |
| Average Mass | 424.490 |
| Monoisotopic Mass | 424.20972 |
| SMILES | C[C@H](CCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2ccc(O)cc2)C[C@H]1O |
| InChI | InChI=1S/C22H32O8/c1-14(7-5-3-4-6-8-20(25)26)28-22-18(24)13-19(15(2)29-22)30-21(27)16-9-11-17(23)12-10-16/h9-12,14-15,18-19,22-24H,3-8,13H2,1-2H3,(H,25,26)/t14-,15+,18-,19-,22-/m1/s1 |
| InChIKey | QPIALCPOHJUWED-PVIPAOTJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in acox-1(ok2257) worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hbas#10 (CHEBI:79330) has functional parent (8R)-8-hydroxynonanoic acid (CHEBI:78839) |
| hbas#10 (CHEBI:79330) has functional parent ascr#10 (CHEBI:78838) |
| hbas#10 (CHEBI:79330) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| hbas#10 (CHEBI:79330) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| hbas#10 (CHEBI:79330) is a 4-O-(p-hydroxybenzoyl)ascaroside (CHEBI:79320) |
| hbas#10 (CHEBI:79330) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (8R)-8-{[3,6-dideoxy-4-O-(4-hydroxybenzoyl)-α-L-arabino-hexopyranosyl]oxy}nonanoic acid |
| Synonym | Source |
|---|---|
| 8R-(3'R-hydroxy-5'R-O-(4-hydroxybenzoyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| hbas%2310 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233442 | Reaxys |
| CAS:1355683-67-8 | SMID |
| Citations |
|---|