EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27O6 |
| Net Charge | -1 |
| Average Mass | 303.375 |
| Monoisotopic Mass | 303.18131 |
| SMILES | C[C@H](CCCCCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O6/c1-10(7-5-3-4-6-8-14(18)19)20-15-13(17)9-12(16)11(2)21-15/h10-13,15-17H,3-9H2,1-2H3,(H,18,19)/p-1/t10-,11+,12-,13-,15-/m1/s1 |
| InChIKey | MILZHQPVNOSJIP-WPLOAARJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#10(1−) (CHEBI:139615) is a monocarboxylic acid anion (CHEBI:35757) |
| ascr#10(1−) (CHEBI:139615) is conjugate base of ascr#10 (CHEBI:78838) |
| Incoming Relation(s) |
| icas#10(1−) (CHEBI:140801) has functional parent ascr#10(1−) (CHEBI:139615) |
| ascr#10 (CHEBI:78838) is conjugate acid of ascr#10(1−) (CHEBI:139615) |
| IUPAC Name |
|---|
| (8R)-8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]nonanoate |
| Synonyms | Source |
|---|---|
| ascr#10 anion | ChEBI |
| asc-C9 anion | ChEBI |
| asc-C9(1−) | ChEBI |