EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O3 |
| Net Charge | 0 |
| Average Mass | 144.170 |
| Monoisotopic Mass | 144.07864 |
| SMILES | C[C@@H](O)CC/C=C/C(=O)O |
| InChI | InChI=1S/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h3,5-6,8H,2,4H2,1H3,(H,9,10)/b5-3+/t6-/m1/s1 |
| InChIKey | GFPZLKGSTFJNHK-MXTDHUQFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) has functional parent (E)-hept-2-enoic acid (CHEBI:38364) |
| (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) is a medium-chain fatty acid (CHEBI:59554) |
| (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| ascr#7 (CHEBI:78830) has functional parent (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) |
| icas#7 (CHEBI:79023) has functional parent (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) |