EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O2 |
| Net Charge | 0 |
| Average Mass | 128.171 |
| Monoisotopic Mass | 128.08373 |
| SMILES | CCCC/C=C/C(=O)O |
| InChI | InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
| InChIKey | YURNCBVQZBJDAJ-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-hept-2-enoic acid (CHEBI:38364) has functional parent (E)-hept-2-enal (CHEBI:143912) |
| (E)-hept-2-enoic acid (CHEBI:38364) is a 2-heptenoic acid (CHEBI:36152) |
| (E)-hept-2-enoic acid (CHEBI:38364) is conjugate acid of (E)-hept-2-enoate (CHEBI:143913) |
| Incoming Relation(s) |
| (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) has functional parent (E)-hept-2-enoic acid (CHEBI:38364) |
| (2Z)-3-bromohept-2-enoic acid (CHEBI:34329) has functional parent (E)-hept-2-enoic acid (CHEBI:38364) |
| (E)-hept-2-enoate (CHEBI:143913) is conjugate base of (E)-hept-2-enoic acid (CHEBI:38364) |
| IUPAC Name |
|---|
| (2E)-hept-2-enoic acid |
| Synonyms | Source |
|---|---|
| (E)-hept-2-enoic acid | ChemIDplus |
| hept-2t-enoic acid | ChEBI |
| Hept-2t-ensäure | ChEBI |
| trans-Hept-2-ensäure | ChEBI |
| (E)-2-heptenoic acid | ChEBI |
| trans-hept-2-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030012 | LIPID MAPS |
| HMDB0031484 | HMDB |
| FDB014141 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720909 | Reaxys |
| CAS:10352-88-2 | ChemIDplus |