EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O6 |
| Net Charge | 0 |
| Average Mass | 274.313 |
| Monoisotopic Mass | 274.14164 |
| SMILES | C[C@H](CC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C13H22O6/c1-8(5-3-4-6-12(16)17)18-13-11(15)7-10(14)9(2)19-13/h4,6,8-11,13-15H,3,5,7H2,1-2H3,(H,16,17)/b6-4+/t8-,9+,10-,11-,13-/m1/s1 |
| InChIKey | GGHOMCWJOMBZEK-LHYQPRBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (19346493) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#7 (CHEBI:78830) has functional parent (2E,6R)-6-hydroxyhept-2-enoic acid (CHEBI:78831) |
| ascr#7 (CHEBI:78830) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#7 (CHEBI:78830) has role pheromone (CHEBI:26013) |
| ascr#7 (CHEBI:78830) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#7 (CHEBI:78830) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#7 (CHEBI:78830) is conjugate acid of ascr#7(1-) (CHEBI:139710) |
| Incoming Relation(s) |
| ascr#7-CoA (CHEBI:139711) has functional parent ascr#7 (CHEBI:78830) |
| ascr#8 (CHEBI:78834) has functional parent ascr#7 (CHEBI:78830) |
| icas#7 (CHEBI:79023) has functional parent ascr#7 (CHEBI:78830) |
| ascr#7(1-) (CHEBI:139710) is conjugate base of ascr#7 (CHEBI:78830) |
| IUPAC Name |
|---|
| (2E,6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hept-2-enoic acid |
| Synonym | Source |
|---|---|
| 6R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-heptenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%237%0D | SMID |
| LMFA13040006 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233384 | Reaxys |
| CAS:1139837-37-8 | SMID |
| Citations |
|---|