EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO7 |
| Net Charge | 0 |
| Average Mass | 393.436 |
| Monoisotopic Mass | 393.17875 |
| SMILES | C[C@H](CC/C=C/C(=O)Nc1ccc(C(=O)O)cc1)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H27NO7/c1-12(27-20-17(23)11-16(22)13(2)28-20)5-3-4-6-18(24)21-15-9-7-14(8-10-15)19(25)26/h4,6-10,12-13,16-17,20,22-23H,3,5,11H2,1-2H3,(H,21,24)(H,25,26)/b6-4+/t12-,13+,16-,17-,20-/m1/s1 |
| InChIKey | WMKIQPAVTRWYKZ-XPUFHXNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (19346493) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#8 (CHEBI:78834) has functional parent 4-aminobenzoic acid (CHEBI:30753) |
| ascr#8 (CHEBI:78834) has functional parent ascr#7 (CHEBI:78830) |
| ascr#8 (CHEBI:78834) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#8 (CHEBI:78834) has role pheromone (CHEBI:26013) |
| ascr#8 (CHEBI:78834) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#8 (CHEBI:78834) is a carboxamide (CHEBI:37622) |
| ascr#8 (CHEBI:78834) is a monocarboxylic acid (CHEBI:25384) |
| ascr#8 (CHEBI:78834) is conjugate acid of ascr#8(1-) (CHEBI:139713) |
| Incoming Relation(s) |
| ascr#8(1-) (CHEBI:139713) is conjugate base of ascr#8 (CHEBI:78834) |
| IUPAC Name |
|---|
| 4-({(2E,6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hept-2-enoyl}amino)benzoic acid |
| Synonym | Source |
|---|---|
| N-(6'R-[3''R,5''R-dihydroxy-6''S-methyl-(2H)-tetrahydropyran-2'-yloxy]-2'E-heptenoyl)-4-aminobenzoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%238%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233428 | Reaxys |
| CAS:1172120-40-9 | SMID |
| Citations |
|---|