EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24O6 |
| Net Charge | 0 |
| Average Mass | 276.329 |
| Monoisotopic Mass | 276.15729 |
| SMILES | C[C@H](CCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C13H24O6/c1-8(5-3-4-6-12(16)17)18-13-11(15)7-10(14)9(2)19-13/h8-11,13-15H,3-7H2,1-2H3,(H,16,17)/t8-,9+,10-,11-,13-/m1/s1 |
| InChIKey | KBTQMAFDKPKMEJ-UYNYGYNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panagrellus redivivus (ncbitaxon:6233) | - | PubMed (23213209) | Produced by female |
| Pristionchus pacificus (ncbitaxon:54126) | - | PubMed (23161728) | |
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (15690045) | dauer inducing |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#1 (CHEBI:78786) has functional parent (6R)-6-hydroxyheptanoic acid (CHEBI:78775) |
| ascr#1 (CHEBI:78786) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#1 (CHEBI:78786) has role pheromone (CHEBI:26013) |
| ascr#1 (CHEBI:78786) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#1 (CHEBI:78786) is a monocarboxylic acid (CHEBI:25384) |
| ascr#1 (CHEBI:78786) is conjugate acid of ascr#1(1−) (CHEBI:139614) |
| Incoming Relation(s) |
| ascr#1-CoA (CHEBI:139645) has functional parent ascr#1 (CHEBI:78786) |
| glas#1 (CHEBI:79197) has functional parent ascr#1 (CHEBI:78786) |
| icas#1 (CHEBI:79051) has functional parent ascr#1 (CHEBI:78786) |
| ascr#1(1−) (CHEBI:139614) is conjugate base of ascr#1 (CHEBI:78786) |
| IUPAC Name |
|---|
| (6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoic acid |
| Synonyms | Source |
|---|---|
| (−)-daumone | ChEBI |
| daumone | ChEBI |
| (−)-6R-(3'R,5'R-dihydroxy-6'S-methyltetrahydro-pyran-2'-R-yloxy)heptanoic acid | ChEBI |
| daumone-1 | SMID |
| (−)-6R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)heptanoic acid | SMID |
| ascaroside C7 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%231%0D | SMID |
| WO2005075491 | Patent |
| LMFA13040002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10093613 | Reaxys |
| CAS:690991-47-0 | SMID |
| Citations |
|---|