EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H23O6 |
| Net Charge | -1 |
| Average Mass | 275.321 |
| Monoisotopic Mass | 275.15001 |
| SMILES | C[C@H](CCCCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C13H24O6/c1-8(5-3-4-6-12(16)17)18-13-11(15)7-10(14)9(2)19-13/h8-11,13-15H,3-7H2,1-2H3,(H,16,17)/p-1/t8-,9+,10-,11-,13-/m1/s1 |
| InChIKey | KBTQMAFDKPKMEJ-UYNYGYNWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#1(1−) (CHEBI:139614) is a monocarboxylic acid anion (CHEBI:35757) |
| ascr#1(1−) (CHEBI:139614) is conjugate base of ascr#1 (CHEBI:78786) |
| Incoming Relation(s) |
| icas#1(1−) (CHEBI:140800) has functional parent ascr#1(1−) (CHEBI:139614) |
| ascr#1 (CHEBI:78786) is conjugate acid of ascr#1(1−) (CHEBI:139614) |
| IUPAC Name |
|---|
| (6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoate |
| Synonyms | Source |
|---|---|
| asc-C7(1−) | ChEBI |
| asc-C7 anion | ChEBI |
| ascr#1 anion | ChEBI |