EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34O11 |
| Net Charge | 0 |
| Average Mass | 438.470 |
| Monoisotopic Mass | 438.21011 |
| SMILES | C[C@H](CCCCC(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H34O11/c1-9(27-18-12(22)7-11(21)10(2)28-18)5-3-4-6-14(23)30-19-17(26)16(25)15(24)13(8-20)29-19/h9-13,15-22,24-26H,3-8H2,1-2H3/t9-,10+,11-,12-,13-,15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | MVQVASRYTUDSCI-POLQEPQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glas#1 (CHEBI:79197) has functional parent ascr#1 (CHEBI:78786) |
| glas#1 (CHEBI:79197) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| glas#1 (CHEBI:79197) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| glas#1 (CHEBI:79197) is a ascarosyloxycarboxylic acid β-D-glucopyranosyl ester (CHEBI:79198) |
| IUPAC Name |
|---|
| 1-O-{(6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoyl}-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| (6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoic acid β-D-glucopyranos-1-yl ester | ChEBI |
| (6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoic acid β-D-glucopyranosyl ester | ChEBI |
| ascr#1 β-D-glucopyranos-1-yl ester | ChEBI |
| ascr#1 β-D-glucopyranosyl ester | ChEBI |
| β-D-glucopyranos-1-yl (6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoate | ChEBI |
| β-D-glucopyranosyl (6R)-6-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptanoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| glas%231 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233476 | Reaxys |
| Citations |
|---|