EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O3 |
| Net Charge | 0 |
| Average Mass | 146.186 |
| Monoisotopic Mass | 146.09429 |
| SMILES | C[C@@H](O)CCCCC(=O)O |
| InChI | InChI=1S/C7H14O3/c1-6(8)4-2-3-5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | UBIZMIFHVVCVEJ-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6R)-6-hydroxyheptanoic acid (CHEBI:78775) is a 6-hydroxyheptanoic acid (CHEBI:78774) |
| (6R)-6-hydroxyheptanoic acid (CHEBI:78775) is enantiomer of (6S)-6-hydroxyheptanoic acid (CHEBI:78781) |
| Incoming Relation(s) |
| ascr#1 (CHEBI:78786) has functional parent (6R)-6-hydroxyheptanoic acid (CHEBI:78775) |
| (6S)-6-hydroxyheptanoic acid (CHEBI:78781) is enantiomer of (6R)-6-hydroxyheptanoic acid (CHEBI:78775) |
| IUPAC Name |
|---|
| (6R)-6-hydroxyheptanoic acid |
| Synonym | Source |
|---|---|
| (R)-6-hydroxyheptanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5241079 | Reaxys |