EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31N2O5 |
| Net Charge | -1 |
| Average Mass | 367.466 |
| Monoisotopic Mass | 367.22385 |
| SMILES | [H][C@@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC)[C@H](C(=O)[O-])C2 |
| InChI | InChI=1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/p-1/t12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | IPVQLZZIHOAWMC-QXKUPLGCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perindopril(1−) (CHEBI:78000) is a monocarboxylic acid anion (CHEBI:35757) |
| perindopril(1−) (CHEBI:78000) is conjugate base of perindopril (CHEBI:8024) |
| Incoming Relation(s) |
| perindopril arginine (CHEBI:77655) has part perindopril(1−) (CHEBI:78000) |
| perindopril erbumine (CHEBI:8025) has part perindopril(1−) (CHEBI:78000) |
| perindopril (CHEBI:8024) is conjugate acid of perindopril(1−) (CHEBI:78000) |
| IUPAC Name |
|---|
| (2S,3aS,7aS)-1-{(2S)-2-[(1S)-1-(ethoxycarbonyl)butylamino]propanoyl}octahydro-1H-indole-2-carboxylate |