EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N2O5 |
| Net Charge | 0 |
| Average Mass | 368.474 |
| Monoisotopic Mass | 368.23112 |
| SMILES | [H][C@@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | IPVQLZZIHOAWMC-QXKUPLGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perindopril (CHEBI:8024) has role antihypertensive agent (CHEBI:35674) |
| perindopril (CHEBI:8024) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| perindopril (CHEBI:8024) is a dicarboxylic acid monoester (CHEBI:36244) |
| perindopril (CHEBI:8024) is a ethyl ester (CHEBI:23990) |
| perindopril (CHEBI:8024) is a organic heterobicyclic compound (CHEBI:27171) |
| perindopril (CHEBI:8024) is a α-amino acid ester (CHEBI:46874) |
| perindopril (CHEBI:8024) is conjugate acid of perindopril(1−) (CHEBI:78000) |
| Incoming Relation(s) |
| perindopril(1−) (CHEBI:78000) is conjugate base of perindopril (CHEBI:8024) |
| IUPAC Name |
|---|
| ethyl N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvalinate |
| INNs | Source |
|---|---|
| perindoprilum | ChemIDplus |
| perindopril | ChemIDplus |
| Synonym | Source |
|---|---|
| (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxopentan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C07706 | KEGG COMPOUND |
| D03753 | KEGG DRUG |
| DB00790 | DrugBank |
| Perindopril | Wikipedia |
| HMDB0014928 | HMDB |
| LSM-4080 | LINCS |
| 2108 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4300272 | Reaxys |
| CAS:82834-16-0 | KEGG COMPOUND |
| CAS:82834-16-0 | ChemIDplus |
| Citations |
|---|