EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N2O5 |
| Net Charge | 0 |
| Average Mass | 368.474 |
| Monoisotopic Mass | 368.23112 |
| SMILES | [H][C@@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | IPVQLZZIHOAWMC-QXKUPLGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perindopril (CHEBI:8024) has role antidepressant (CHEBI:35469) |
| perindopril (CHEBI:8024) has role antihypertensive agent (CHEBI:35674) |
| perindopril (CHEBI:8024) has role antineoplastic agent (CHEBI:35610) |
| perindopril (CHEBI:8024) has role cardiovascular drug (CHEBI:35554) |
| perindopril (CHEBI:8024) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| perindopril (CHEBI:8024) has role hypoglycemic agent (CHEBI:35526) |
| perindopril (CHEBI:8024) is a dicarboxylic acid monoester (CHEBI:36244) |
| perindopril (CHEBI:8024) is a ethyl ester (CHEBI:23990) |
| perindopril (CHEBI:8024) is a organic heterobicyclic compound (CHEBI:27171) |
| perindopril (CHEBI:8024) is a α-amino acid ester (CHEBI:46874) |
| perindopril (CHEBI:8024) is conjugate acid of perindopril(1−) (CHEBI:78000) |
| Incoming Relation(s) |
| perindopril(1−) (CHEBI:78000) is conjugate base of perindopril (CHEBI:8024) |
| IUPAC Name |
|---|
| ethyl N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvalinate |
| INNs | Source |
|---|---|
| perindopril | ChemIDplus |
| perindoprilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxopentan-2-yl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid | IUPAC |
| MCN-A-2833 | ChEMBL |
| S-9490 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2108 | DrugCentral |
| C07706 | KEGG COMPOUND |
| D03753 | KEGG DRUG |
| DB00790 | DrugBank |
| HMDB0014928 | HMDB |
| LSM-4080 | LINCS |
| Perindopril | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4300272 | Reaxys |
| CAS:82834-16-0 | ChemIDplus |
| CAS:82834-16-0 | KEGG COMPOUND |
| Citations |
|---|