EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N2O5.C6H14N4O2 |
| Net Charge | 0 |
| Average Mass | 542.678 |
| Monoisotopic Mass | 542.34280 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)O.[H][C@@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C19H32N2O5.C6H14N4O2/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24;7-4(5(11)12)2-1-3-10-6(8)9/h12-16,20H,4-11H2,1-3H3,(H,23,24);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t12-,13-,14-,15-,16-;4-/m00/s1 |
| InChIKey | RYCSJJXKEWBUTI-YDYAIEMNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perindopril arginine (CHEBI:77655) has part L-argininium(1+) (CHEBI:32682) |
| perindopril arginine (CHEBI:77655) has part perindopril(1−) (CHEBI:78000) |
| perindopril arginine (CHEBI:77655) has role antihypertensive agent (CHEBI:35674) |
| perindopril arginine (CHEBI:77655) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| perindopril arginine (CHEBI:77655) is a organoammonium salt (CHEBI:46850) |
| Incoming Relation(s) |
| Prestalia (CHEBI:85999) has part perindopril arginine (CHEBI:77655) |
| Synonym | Source |
|---|---|
| perindopril L-arginine salt | ChEBI |
| Brand Name | Source |
|---|---|
| Coversyl | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP2161257 | Patent |
| IL164424 | Patent |
| NZ570366 | Patent |
| Perindopril | Wikipedia |
| PT2016051E | Patent |
| RS51431 | Patent |
| US2009203758 | Patent |
| US2013178464 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19333045 | Reaxys |
| CAS:612548-45-5 | ChemIDplus |
| Citations |
|---|