EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N2O5.C4H11N |
| Net Charge | 0 |
| Average Mass | 441.613 |
| Monoisotopic Mass | 441.32027 |
| SMILES | CC(C)(C)N.[H][C@@]12CCCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C19H32N2O5.C4H11N/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24;1-4(2,3)5/h12-16,20H,4-11H2,1-3H3,(H,23,24);5H2,1-3H3/t12-,13-,14-,15-,16-;/m0./s1 |
| InChIKey | IYNMDWMQHSMDDE-MHXJNQAMSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perindopril erbumine (CHEBI:8025) has part perindopril(1−) (CHEBI:78000) |
| perindopril erbumine (CHEBI:8025) has role antihypertensive agent (CHEBI:35674) |
| perindopril erbumine (CHEBI:8025) has role cardiovascular drug (CHEBI:35554) |
| perindopril erbumine (CHEBI:8025) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| perindopril erbumine (CHEBI:8025) is a addition compound (CHEBI:35504) |
| IUPAC Name |
|---|
| (2S,3aS,7aS)-1-{(2S)-2-[(1S)-1-(ethoxycarbonyl)butylamino]propanoyl}octahydro-1H-indole-2-carboxylic acid—2-methylpropan-2-amine (1/1) |
| Synonyms | Source |
|---|---|
| (2S,3aS,7aS)-1-{(S)-2-[(S)-1-(ethoxycarbonyl)butylamino]propanoyl}octahydroindole-2-carboxylic acid—1,1-dimethylethanamine (1/1) | ChEBI |
| (2S,3aS,7aS)-1-((S)-N-((S)-1-Carboxybutyl)alanyl)hexahydro-2-indolinecarboxylic acid, 1-ethyl ester, compound with tert-butylamine (1:1) | ChemIDplus |
| MCN-A-2833-109 | ChEMBL |
| NSC-758929 | ChEMBL |
| Perindopril erbumine | KEGG COMPOUND |
| Perindopril tert-butylamine | ChEMBL |
| Brand Names | Source |
|---|---|
| Aceon | DrugBank |
| Perindopril erbumine component of amlessa | ChEMBL |
| Citations |
|---|