EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77868 - potassium sorbate
| Formula | C6H7O2.K |
| Net Charge | 0 |
| Average Mass | 150.218 |
| Monoisotopic Mass | 150.00831 |
| SMILES | C/C=C/C=C/C(=O)[O-].[K+] |
| InChI | InChI=1S/C6H8O2.K/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+; |
| InChIKey | CHHHXKFHOYLYRE-STWYSWDKSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Application: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium sorbate (CHEBI:77868) has part (E,E)-sorbate (CHEBI:77869) |
| potassium sorbate (CHEBI:77868) has role antimicrobial food preservative (CHEBI:65256) |
| potassium sorbate (CHEBI:77868) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium (2E,4E)-hexa-2,4-dienoate |
| Synonyms | Source |
|---|---|
| Potassium (E,E)-2,4-hexadienoate | ChemIDplus |
| Potassium (E,E)-sorbate | ChemIDplus |
| potassium trans,trans-2,4-hexadienoate | ChEBI |
| potassium trans,trans-sorbate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D02411 | KEGG DRUG |
| Potassium_sorbate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5357554 | Reaxys |
| CAS:24634-61-5 | ChemIDplus |
| Citations |
|---|