EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O2 |
| Net Charge | -1 |
| Average Mass | 111.120 |
| Monoisotopic Mass | 111.04515 |
| SMILES | [H]C(C)=CC([H])=CC(=O)[O-] |
| InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8)/p-1 |
| InChIKey | WSWCOQWTEOXDQX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sorbate (CHEBI:36550) is a hexadienoate (CHEBI:24554) |
| sorbate (CHEBI:36550) is conjugate base of sorbic acid (CHEBI:35962) |
| Incoming Relation(s) |
| 2-hydroxy-6-(2-hydroxyphenoxy)-6-oxo-cis,cis-hexa-2,4-dienoate (CHEBI:19327) has functional parent sorbate (CHEBI:36550) |
| 2-hydroxy-6-(2-hydroxyphenyl)-6-oxo-cis,cis-hexa-2,4-dienoate (CHEBI:36538) has functional parent sorbate (CHEBI:36550) |
| (E,E)-sorbate (CHEBI:77869) is a sorbate (CHEBI:36550) |
| sorbic acid (CHEBI:35962) is conjugate acid of sorbate (CHEBI:36550) |
| IUPAC Name |
|---|
| hexa-2,4-dienoate |
| Synonym | Source |
|---|---|
| hexa-2,4-dienoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3931312 | Beilstein |