EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15O3 |
| Net Charge | -1 |
| Average Mass | 171.216 |
| Monoisotopic Mass | 171.10267 |
| SMILES | [H]C(=O)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C9H16O3/c10-8-6-4-2-1-3-5-7-9(11)12/h8H,1-7H2,(H,11,12)/p-1 |
| InChIKey | WLGDDELKYAWBBL-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-oxononanoate (CHEBI:77812) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| 9-oxononanoate (CHEBI:77812) is a aldehydic acid anion (CHEBI:71944) |
| 9-oxononanoate (CHEBI:77812) is a medium-chain fatty acid anion (CHEBI:59558) |
| 9-oxononanoate (CHEBI:77812) is a ω-oxo fatty acid anion (CHEBI:76309) |
| 9-oxononanoate (CHEBI:77812) is conjugate base of 9-oxononanoic acid (CHEBI:78700) |
| Incoming Relation(s) |
| 9-oxononanoic acid (CHEBI:78700) is conjugate acid of 9-oxononanoate (CHEBI:77812) |
| IUPAC Name |
|---|
| 9-oxononanoate |
| Synonym | Source |
|---|---|
| 9-ketononanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 9-oxononanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8686 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23888971 | Reaxys |
| Citations |
|---|