EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O3 |
| Net Charge | 0 |
| Average Mass | 172.224 |
| Monoisotopic Mass | 172.10994 |
| SMILES | [H]C(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C9H16O3/c10-8-6-4-2-1-3-5-7-9(11)12/h8H,1-7H2,(H,11,12) |
| InChIKey | WLGDDELKYAWBBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-oxononanoic acid (CHEBI:78700) has functional parent nonanoic acid (CHEBI:29019) |
| 9-oxononanoic acid (CHEBI:78700) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| 9-oxononanoic acid (CHEBI:78700) is a aldehydic acid (CHEBI:26643) |
| 9-oxononanoic acid (CHEBI:78700) is a medium-chain fatty acid (CHEBI:59554) |
| 9-oxononanoic acid (CHEBI:78700) is a ω-oxo fatty acid (CHEBI:76328) |
| 9-oxononanoic acid (CHEBI:78700) is conjugate acid of 9-oxononanoate (CHEBI:77812) |
| Incoming Relation(s) |
| 1-hexadecanoyl-2-(9-oxononanoyl)-sn-glycero-3-phosphocholine (CHEBI:61042) has functional parent 9-oxononanoic acid (CHEBI:78700) |
| 9-oxononanoate (CHEBI:77812) is conjugate base of 9-oxononanoic acid (CHEBI:78700) |
| IUPAC Name |
|---|
| 9-oxononanoic acid |
| Synonyms | Source |
|---|---|
| 8-formyloctanoic acid | ChEBI |
| 9-ketononanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16322 | KEGG COMPOUND |
| CPD-8686 | MetaCyc |
| LMFA01060160 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1762686 | Reaxys |
| CAS:2553-17-5 | ChemIDplus |
| CAS:2553-17-5 | KEGG COMPOUND |
| Citations |
|---|