EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15673 - meso-tartaric acid
| Formula | C4H6O6 |
| Net Charge | 0 |
| Average Mass | 150.086 |
| Monoisotopic Mass | 150.01644 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2+ |
| InChIKey | FEWJPZIEWOKRBE-XIXRPRMCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meso-tartaric acid (CHEBI:15673) is a 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| meso-tartaric acid (CHEBI:15673) is conjugate acid of meso-tartrate(1−) (CHEBI:35400) |
| Incoming Relation(s) |
| (2R,3S)-cis-coutaric acid (CHEBI:76096) has functional parent meso-tartaric acid (CHEBI:15673) |
| (2R,3S)-trans-coutaric acid (CHEBI:76095) has functional parent meso-tartaric acid (CHEBI:15673) |
| (2S,3R)-cis-caftaric acid (CHEBI:76082) has functional parent meso-tartaric acid (CHEBI:15673) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) has functional parent meso-tartaric acid (CHEBI:15673) |
| meso-tartrate(1−) (CHEBI:35400) is conjugate base of meso-tartaric acid (CHEBI:15673) |
| IUPAC Name |
|---|
| (2R,3S)-2,3-dihydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| (2R,3S)-2,3-dihydroxysuccinic acid | ChEBI |
| (2R,3S)-rel-2,3-dihydroxybutanedioic acid | ChemIDplus |
| (2R,3S)-tartaric acid | IUPAC |
| i-tartaric acid | ChEBI |
| erythraric acid | IUPAC |
| meso-tartaric acid | IUPAC |
| Citations |
|---|