EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O7 |
| Net Charge | +1 |
| Average Mass | 317.273 |
| Monoisotopic Mass | 317.06558 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc(O)c1O |
| InChI | InChI=1S/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p+1 |
| InChIKey | AFOLOMGWVXKIQL-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petunidin (CHEBI:75318) has role plant metabolite (CHEBI:76924) |
| petunidin (CHEBI:75318) is a 5-hydroxyanthocyanidin (CHEBI:140277) |
| petunidin (CHEBI:75318) is conjugate acid of petunidin(1−) (CHEBI:193101) |
| Incoming Relation(s) |
| petunidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75709) has functional parent petunidin (CHEBI:75318) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) has functional parent petunidin (CHEBI:75318) |
| petunidin 3-O-β-D-glucoside (CHEBI:31985) has functional parent petunidin (CHEBI:75318) |
| petunidin(1−) (CHEBI:193101) is conjugate base of petunidin (CHEBI:75318) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxychromenium |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1-benzopyrylium | ChEBI |
| 3,3',4',5,7-pentahydroxy-5'-methoxyflavylium | ChEBI |
| petunidol | ChEBI |
| Pt | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-15003 | MetaCyc |
| FDB002755 | FooDB |
| HMDB0003173 | HMDB |
| LMPK12010005 | LIPID MAPS |
| P5M | PDBeChem |
| Petunidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3914715 | Reaxys |
| CAS:13270-60-5 | HMDB |
| Citations |
|---|