EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11O7 |
| Net Charge | -1 |
| Average Mass | 315.257 |
| Monoisotopic Mass | 315.05103 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc([O-])c3cc2[O-])cc(O)c1O |
| InChI | InChI=1S/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p-1 |
| InChIKey | AFOLOMGWVXKIQL-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petunidin(1−) (CHEBI:193101) is a anthocyanidin betaine (CHEBI:143576) |
| petunidin(1−) (CHEBI:193101) is conjugate base of petunidin (CHEBI:75318) |
| Incoming Relation(s) |
| petunidin 3-O-β-D-galactoside betaine (CHEBI:193102) has functional parent petunidin(1−) (CHEBI:193101) |
| petunidin (CHEBI:75318) is conjugate acid of petunidin(1−) (CHEBI:193101) |
| UniProt Name | Source |
|---|---|
| petunidin | UniProt |
| Citations |
|---|