EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23O12 |
| Net Charge | +1 |
| Average Mass | 479.414 |
| Monoisotopic Mass | 479.11840 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c1O |
| InChI | InChI=1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1 |
| InChIKey | CCQDWIRWKWIUKK-QKYBYQKWSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petunidin 3-O-β-D-glucoside (CHEBI:31985) has functional parent petunidin (CHEBI:75318) |
| petunidin 3-O-β-D-glucoside (CHEBI:31985) has role antioxidant (CHEBI:22586) |
| petunidin 3-O-β-D-glucoside (CHEBI:31985) has role metabolite (CHEBI:25212) |
| petunidin 3-O-β-D-glucoside (CHEBI:31985) is a anthocyanin cation (CHEBI:35218) |
| petunidin 3-O-β-D-glucoside (CHEBI:31985) is a aromatic ether (CHEBI:35618) |
| petunidin 3-O-β-D-glucoside (CHEBI:31985) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromenium-3-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Petunidin 3-glucoside | KEGG COMPOUND |
| Petunidin 3-O-β-D-glucopyranoside | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C12139 | KEGG COMPOUND |
| Petunidin-3-O-glucoside | Wikipedia |
| HMDB0038097 | HMDB |
| LMPK12010349 | LIPID MAPS |
| C00006722 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1613022 | Reaxys |
| CAS:6988-81-4 | KEGG COMPOUND |