EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O2 |
| Net Charge | 0 |
| Average Mass | 116.160 |
| Monoisotopic Mass | 116.08373 |
| SMILES | CC(C)CCC(=O)O |
| InChI | InChI=1S/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | FGKJLKRYENPLQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocaproic acid (CHEBI:74903) has role human metabolite (CHEBI:77746) |
| isocaproic acid (CHEBI:74903) is a branched-chain saturated fatty acid (CHEBI:39417) |
| isocaproic acid (CHEBI:74903) is a medium-chain fatty acid (CHEBI:59554) |
| isocaproic acid (CHEBI:74903) is a methyl-branched fatty acid (CHEBI:62499) |
| isocaproic acid (CHEBI:74903) is conjugate acid of isocaproate (CHEBI:74904) |
| Incoming Relation(s) |
| (2E)-2-(hydroxyimino)isohexanoic acid (CHEBI:131356) has functional parent isocaproic acid (CHEBI:74903) |
| 4-methylpentanoyl-CoA (CHEBI:131951) has functional parent isocaproic acid (CHEBI:74903) |
| isocaproate (CHEBI:74904) is conjugate base of isocaproic acid (CHEBI:74903) |
| IUPAC Name |
|---|
| 4-methylpentanoic acid |
| Synonyms | Source |
|---|---|
| 4,4-Dimethylbutanoic acid | HMDB |
| 4-Methyl-N-valeric acid | HMDB |
| 4-Methyl-pentanoic acid | HMDB |
| 4-Methylvaleric acid | HMDB |
| 4-Methyl-Valeric acid | HMDB |
| Isobutylacetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 4MV | PDBeChem |
| DB03993 | DrugBank |
| HMDB0000689 | HMDB |
| LMFA01020076 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1741912 | Reaxys |
| CAS:646-07-1 | ChemIDplus |
| Citations |
|---|