EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | CC(C)C/C(=N\O)C(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-4(2)3-5(7-10)6(8)9/h4,10H,3H2,1-2H3,(H,8,9)/b7-5+ |
| InChIKey | BXFMNNVJFIGVDJ-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-2-(hydroxyimino)isohexanoic acid (CHEBI:131356) has functional parent isocaproic acid (CHEBI:74903) |
| (2E)-2-(hydroxyimino)isohexanoic acid (CHEBI:131356) is a ketoxime (CHEBI:24983) |
| (2E)-2-(hydroxyimino)isohexanoic acid (CHEBI:131356) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2E)-2-(hydroxyimino)-4-methylpentanoic acid |
| Synonym | Source |
|---|---|
| (2E)-2-(hydroxyimino)isocaproic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6917564 | Reaxys |