EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46N7O17P3S |
| Net Charge | 0 |
| Average Mass | 865.686 |
| Monoisotopic Mass | 865.18837 |
| SMILES | CC(C)CCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C27H46N7O17P3S/c1-15(2)5-6-18(36)55-10-9-29-17(35)7-8-30-25(39)22(38)27(3,4)12-48-54(45,46)51-53(43,44)47-11-16-21(50-52(40,41)42)20(37)26(49-16)34-14-33-19-23(28)31-13-32-24(19)34/h13-16,20-22,26,37-38H,5-12H2,1-4H3,(H,29,35)(H,30,39)(H,43,44)(H,45,46)(H2,28,31,32)(H2,40,41,42)/t16-,20-,21-,22+,26-/m1/s1 |
| InChIKey | GESPQCUXDWNNGU-HDRQGHTBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peptoclostridium difficile (ncbitaxon:1496) | - | PubMed (16957230) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylpentanoyl-CoA (CHEBI:131951) has functional parent isocaproic acid (CHEBI:74903) |
| 4-methylpentanoyl-CoA (CHEBI:131951) is a methyl-branched fatty acyl-CoA (CHEBI:25271) |
| 4-methylpentanoyl-CoA (CHEBI:131951) is a short-chain fatty acyl-CoA (CHEBI:61905) |
| 4-methylpentanoyl-CoA (CHEBI:131951) is conjugate acid of 4-methylpentanoyl-CoA(4−) (CHEBI:131445) |
| Incoming Relation(s) |
| 4-methylpentanoyl-CoA(4−) (CHEBI:131445) is conjugate base of 4-methylpentanoyl-CoA (CHEBI:131951) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(4-methylpentanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| isocaproyl-CoA | ChEBI |
| isocaproyl-coenzyme A | ChEBI |
| isohexanoyl-coenzyme A | ChEBI |
| 4-methylpentanoyl-coenzyme A | ChEBI |
| isohexanoyl-CoA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17494 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10324490 | Reaxys |
| Citations |
|---|