EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O2 |
| Net Charge | -1 |
| Average Mass | 115.152 |
| Monoisotopic Mass | 115.07645 |
| SMILES | CC(C)CCC(=O)[O-] |
| InChI | InChI=1S/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/p-1 |
| InChIKey | FGKJLKRYENPLQH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocaproate (CHEBI:74904) has role metabolite (CHEBI:25212) |
| isocaproate (CHEBI:74904) is a branched-chain saturated fatty acid anion (CHEBI:58956) |
| isocaproate (CHEBI:74904) is a medium-chain fatty acid anion (CHEBI:59558) |
| isocaproate (CHEBI:74904) is conjugate base of isocaproic acid (CHEBI:74903) |
| Incoming Relation(s) |
| isocaproic acid (CHEBI:74903) is conjugate acid of isocaproate (CHEBI:74904) |
| IUPAC Name |
|---|
| 4-methylpentanoate |
| Synonyms | Source |
|---|---|
| 4-Methylvalerate | ChEBI |
| 4-Methyl-Valerate | ChEBI |
| Isohexoate | ChEBI |
| 4-Methyl-N-valerate | ChEBI |
| Isobutylacetate | ChEBI |
| 4,4-Dimethylbutanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-methylpentanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3903785 | Reaxys |