EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | COC(=O)[C@H](C)O |
| InChI | InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3/t3-/m0/s1 |
| InChIKey | LPEKGGXMPWTOCB-VKHMYHEASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (S)-lactate (CHEBI:83222) is a methyl 2-hydroxypropionate (CHEBI:83221) |
| methyl (S)-lactate (CHEBI:83222) is enantiomer of methyl (R)-lactate (CHEBI:74611) |
| Incoming Relation(s) |
| rac-methyl lactate (CHEBI:73641) has part methyl (S)-lactate (CHEBI:83222) |
| methyl (R)-lactate (CHEBI:74611) is enantiomer of methyl (S)-lactate (CHEBI:83222) |
| IUPAC Name |
|---|
| methyl (2S)-2-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| (−)-2-hydroxypropanoic acid methyl ester | ChEBI |
| (−)-2-hydroxypropionic acid methyl ester | ChemIDplus |
| (S)-(−)-lactic acid methyl ester | ChemIDplus |
| (S)-lactic acid methyl ester | ChemIDplus |
| (S)-methyl lactate | ChemIDplus |
| (−)-lactic acid methyl ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720587 | Reaxys |
| CAS:27871-49-4 | ChemIDplus |
| CAS:27871-49-4 | NIST Chemistry WebBook |
| Citations |
|---|