EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | COC(=O)C(C)O |
| InChI | InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3 |
| InChIKey | LPEKGGXMPWTOCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 2-hydroxypropionate (CHEBI:83221) has role metabolite (CHEBI:25212) |
| methyl 2-hydroxypropionate (CHEBI:83221) is a lactate ester (CHEBI:83219) |
| methyl 2-hydroxypropionate (CHEBI:83221) is a methyl ester (CHEBI:25248) |
| Incoming Relation(s) |
| methyl (R)-lactate (CHEBI:74611) is a methyl 2-hydroxypropionate (CHEBI:83221) |
| methyl (S)-lactate (CHEBI:83222) is a methyl 2-hydroxypropionate (CHEBI:83221) |
| IUPAC Name |
|---|
| methyl 2-hydroxypropanoate |
| Synonym | Source |
|---|---|
| methyl lactate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:547-64-8 | NIST Chemistry WebBook |